C24H23N5O2 — CID 123297823
4-(dimethylamino)-1-[4-(3-ethynylanilino)-7,8-dihydropyrimido[5,4-g][1,4]benzoxazin-6-yl]but-2-en-1-one (PubChem CID 123297823) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 4-(dimethylamino)-1-[4-(3-ethynylanilino)-7,8-dihydropyrimido[5,4-g][1,4]benzoxazin-6-yl]but-2-en-1-one.
| Compound Name | 4-(dimethylamino)-1-[4-(3-ethynylanilino)-7,8-dihydropyrimido[5,4-g][1,4]benzoxazin-6-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 123297823 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 4-(dimethylamino)-1-[4-(3-ethynylanilino)-7,8-dihydropyrimido[5,4-g][1,4]benzoxazin-6-yl]but-2-en-1-one |
| SMILES | C#Cc1cccc(Nc2ncnc3cc4c(cc23)N(C(=O)C=CCN(C)C)CCO4)c1 |
| InChI | InChI=1S/C24H23N5O2/c1-4-17-7-5-8-18(13-17)27-24-19-14-21-22(15-20(19)25-16-26-24)31-12-11-29(21)23(30)9-6-10-28(2)3/h1,5-9,13-16H,10-12H2,2-3H3,(H,25,26,27) |
| InChIKey | JFSSINHNDHIGOR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|