C25H18ClFN4O2 — CID 71585563
(E)-1-[4-(3-chloro-4-fluoroanilino)-7,8-dihydropyrimido[5,4-g][1,4]benzoxazin-6-yl]-3-phenylprop-2-en-1-one (PubChem CID 71585563) has the molecular formula C25H18ClFN4O2 and a molecular weight of 460.90 g/mol. Its IUPAC name is (E)-1-[4-(3-chloro-4-fluoroanilino)-7,8-dihydropyrimido[5,4-g][1,4]benzoxazin-6-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[4-(3-chloro-4-fluoroanilino)-7,8-dihydropyrimido[5,4-g][1,4]benzoxazin-6-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 71585563 |
| Molecular Formula | C25H18ClFN4O2 |
| Molecular Weight | 460.90 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | (E)-1-[4-(3-chloro-4-fluoroanilino)-7,8-dihydropyrimido[5,4-g][1,4]benzoxazin-6-yl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)N1CCOc2cc3ncnc(Nc4ccc(F)c(Cl)c4)c3cc21 |
| InChI | InChI=1S/C25H18ClFN4O2/c26-19-12-17(7-8-20(19)27)30-25-18-13-22-23(14-21(18)28-15-29-25)33-11-10-31(22)24(32)9-6-16-4-2-1-3-5-16/h1-9,12-15H,10-11H2,(H,28,29,30)/b9-6+ |
| InChIKey | FGZVEHISQKABHB-RMKNXTFCSA-N |
| XLogP | 5.60 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.90 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|