C29H31N5O2 — CID 123949914
1-[4-(3-ethynylanilino)-8,9-dihydro-7H-pyrimido[5,4-h][1,5]benzoxazepin-6-yl]-4-(2-methylpiperidin-1-yl)but-2-en-1-one (PubChem CID 123949914) has the molecular formula C29H31N5O2 and a molecular weight of 481.60 g/mol. Its IUPAC name is 1-[4-(3-ethynylanilino)-8,9-dihydro-7H-pyrimido[5,4-h][1,5]benzoxazepin-6-yl]-4-(2-methylpiperidin-1-yl)but-2-en-1-one.
| Compound Name | 1-[4-(3-ethynylanilino)-8,9-dihydro-7H-pyrimido[5,4-h][1,5]benzoxazepin-6-yl]-4-(2-methylpiperidin-1-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 123949914 |
| Molecular Formula | C29H31N5O2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | 1-[4-(3-ethynylanilino)-8,9-dihydro-7H-pyrimido[5,4-h][1,5]benzoxazepin-6-yl]-4-(2-methylpiperidin-1-yl)but-2-en-1-one |
| SMILES | C#Cc1cccc(Nc2ncnc3cc4c(cc23)N(C(=O)C=CCN2CCCCC2C)CCCO4)c1 |
| InChI | InChI=1S/C29H31N5O2/c1-3-22-10-6-11-23(17-22)32-29-24-18-26-27(19-25(24)30-20-31-29)36-16-8-15-34(26)28(35)12-7-14-33-13-5-4-9-21(33)2/h1,6-7,10-12,17-21H,4-5,8-9,13-16H2,2H3,(H,30,31,32) |
| InChIKey | ZXWUXTXJLQFCQO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|