C15H13N3O — CID 88918636
N-(3-ethynylphenyl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-7-amine (PubChem CID 88918636) has the molecular formula C15H13N3O and a molecular weight of 251.29 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-7-amine.
| Compound Name | N-(3-ethynylphenyl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-7-amine |
|---|---|
| PubChem CID | 88918636 |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | N-(3-ethynylphenyl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-7-amine |
| SMILES | C#Cc1cccc(Nc2cnc3c(c2)OCCN3)c1 |
| InChI | InChI=1S/C15H13N3O/c1-2-11-4-3-5-12(8-11)18-13-9-14-15(17-10-13)16-6-7-19-14/h1,3-5,8-10,18H,6-7H2,(H,16,17) |
| InChIKey | KWWMRQJHXQRARX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|