C23H21NO5 — CID 167903679
4-[(6,7-dimethoxynaphthalen-2-yl)methylcarbamoyl]cubane-1-carboxylic acid (PubChem CID 167903679) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is 4-[(6,7-dimethoxynaphthalen-2-yl)methylcarbamoyl]cubane-1-carboxylic acid.
| Compound Name | 4-[(6,7-dimethoxynaphthalen-2-yl)methylcarbamoyl]cubane-1-carboxylic acid |
|---|---|
| PubChem CID | 167903679 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 4-[(6,7-dimethoxynaphthalen-2-yl)methylcarbamoyl]cubane-1-carboxylic acid |
| SMILES | COc1cc2ccc(CNC(=O)C34C5C6C3C3C4C5C63C(=O)O)cc2cc1OC |
| InChI | InChI=1S/C23H21NO5/c1-28-12-6-10-4-3-9(5-11(10)7-13(12)29-2)8-24-20(25)22-14-17-15(22)19-16(22)18(14)23(17,19)21(26)27/h3-7,14-19H,8H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | LIBONFUGZHYKIG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |