C22H22F2N2O2 — CID 167906084
2-(5-fluoroindol-1-yl)-1-[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]ethanone (PubChem CID 167906084) has the molecular formula C22H22F2N2O2 and a molecular weight of 384.43 g/mol. Its IUPAC name is 2-(5-fluoroindol-1-yl)-1-[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]ethanone.
| Compound Name | 2-(5-fluoroindol-1-yl)-1-[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 167906084 |
| Molecular Formula | C22H22F2N2O2 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-(5-fluoroindol-1-yl)-1-[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]ethanone |
| SMILES | O=C(Cn1ccc2cc(F)ccc21)N1CCC(C(O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H22F2N2O2/c23-18-3-1-15(2-4-18)22(28)16-7-10-25(11-8-16)21(27)14-26-12-9-17-13-19(24)5-6-20(17)26/h1-6,9,12-13,16,22,28H,7-8,10-11,14H2 |
| InChIKey | VDWNXXSHPWMGGI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |