C22H32N2O3 — CID 167906199
2-[1-[[(1-benzylpiperidine-3-carbonyl)amino]methyl]cyclohexyl]acetic acid (PubChem CID 167906199) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-[1-[[(1-benzylpiperidine-3-carbonyl)amino]methyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[[(1-benzylpiperidine-3-carbonyl)amino]methyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 167906199 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 2-[1-[[(1-benzylpiperidine-3-carbonyl)amino]methyl]cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1(CNC(=O)C2CCCN(Cc3ccccc3)C2)CCCCC1 |
| InChI | InChI=1S/C22H32N2O3/c25-20(26)14-22(11-5-2-6-12-22)17-23-21(27)19-10-7-13-24(16-19)15-18-8-3-1-4-9-18/h1,3-4,8-9,19H,2,5-7,10-17H2,(H,23,27)(H,25,26) |
| InChIKey | HEBUBYOQZYEYQP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |