C7H10N6 — CID 167907347
1,5-dimethyl-4-(1-methyltriazol-4-yl)triazole (PubChem CID 167907347) has the molecular formula C7H10N6 and a molecular weight of 178.20 g/mol. Its IUPAC name is 1,5-dimethyl-4-(1-methyltriazol-4-yl)triazole.
| Compound Name | 1,5-dimethyl-4-(1-methyltriazol-4-yl)triazole |
|---|---|
| PubChem CID | 167907347 |
| Molecular Formula | C7H10N6 |
| Molecular Weight | 178.20 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 1,5-dimethyl-4-(1-methyltriazol-4-yl)triazole |
| SMILES | Cc1c(-c2cn(C)nn2)nnn1C |
| InChI | InChI=1S/C7H10N6/c1-5-7(9-11-13(5)3)6-4-12(2)10-8-6/h4H,1-3H3 |
| InChIKey | WHHAXDQRGIZDRL-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.20 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |