C17H24ClN3O2 — CID 167907697
N'-[2-(aminomethyl)cyclohexyl]-N-[(3-chloro-2-methylphenyl)methyl]oxamide (PubChem CID 167907697) has the molecular formula C17H24ClN3O2 and a molecular weight of 337.85 g/mol. Its IUPAC name is N'-[2-(aminomethyl)cyclohexyl]-N-[(3-chloro-2-methylphenyl)methyl]oxamide.
| Compound Name | N'-[2-(aminomethyl)cyclohexyl]-N-[(3-chloro-2-methylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 167907697 |
| Molecular Formula | C17H24ClN3O2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | N'-[2-(aminomethyl)cyclohexyl]-N-[(3-chloro-2-methylphenyl)methyl]oxamide |
| SMILES | Cc1c(Cl)cccc1CNC(=O)C(=O)NC1CCCCC1CN |
| InChI | InChI=1S/C17H24ClN3O2/c1-11-13(6-4-7-14(11)18)10-20-16(22)17(23)21-15-8-3-2-5-12(15)9-19/h4,6-7,12,15H,2-3,5,8-10,19H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | ZVXBWDJOLMXJPN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|