C15H17F2N5O — CID 167909053
N-(2,3-difluoro-4-pyridinyl)-4-(4-methylpyrazol-1-yl)piperidine-1-carboxamide (PubChem CID 167909053) has the molecular formula C15H17F2N5O and a molecular weight of 321.33 g/mol. Its IUPAC name is N-(2,3-difluoro-4-pyridinyl)-4-(4-methylpyrazol-1-yl)piperidine-1-carboxamide.
| Compound Name | N-(2,3-difluoro-4-pyridinyl)-4-(4-methylpyrazol-1-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 167909053 |
| Molecular Formula | C15H17F2N5O |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | N-(2,3-difluoro-4-pyridinyl)-4-(4-methylpyrazol-1-yl)piperidine-1-carboxamide |
| SMILES | Cc1cnn(C2CCN(C(=O)Nc3ccnc(F)c3F)CC2)c1 |
| InChI | InChI=1S/C15H17F2N5O/c1-10-8-19-22(9-10)11-3-6-21(7-4-11)15(23)20-12-2-5-18-14(17)13(12)16/h2,5,8-9,11H,3-4,6-7H2,1H3,(H,18,20,23) |
| InChIKey | ZSZWIXDHSULTAB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|