C22H28BrN3O — CID 167912499
3-bromo-N-methyl-N-[1-(1-methylpiperidin-4-yl)pyrrolidin-3-yl]naphthalene-1-carboxamide (PubChem CID 167912499) has the molecular formula C22H28BrN3O and a molecular weight of 430.39 g/mol. Its IUPAC name is 3-bromo-N-methyl-N-[1-(1-methylpiperidin-4-yl)pyrrolidin-3-yl]naphthalene-1-carboxamide.
| Compound Name | 3-bromo-N-methyl-N-[1-(1-methylpiperidin-4-yl)pyrrolidin-3-yl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 167912499 |
| Molecular Formula | C22H28BrN3O |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 3-bromo-N-methyl-N-[1-(1-methylpiperidin-4-yl)pyrrolidin-3-yl]naphthalene-1-carboxamide |
| SMILES | CN1CCC(N2CCC(N(C)C(=O)c3cc(Br)cc4ccccc34)C2)CC1 |
| InChI | InChI=1S/C22H28BrN3O/c1-24-10-7-18(8-11-24)26-12-9-19(15-26)25(2)22(27)21-14-17(23)13-16-5-3-4-6-20(16)21/h3-6,13-14,18-19H,7-12,15H2,1-2H3 |
| InChIKey | BQRWKXXNAZZDSD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |