C18H25N3O2 — CID 166085277
2-formyl-N-methyl-N-[1-(1-methylpiperidin-4-yl)azetidin-3-yl]benzamide (PubChem CID 166085277) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-formyl-N-methyl-N-[1-(1-methylpiperidin-4-yl)azetidin-3-yl]benzamide.
| Compound Name | 2-formyl-N-methyl-N-[1-(1-methylpiperidin-4-yl)azetidin-3-yl]benzamide |
|---|---|
| PubChem CID | 166085277 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 2-formyl-N-methyl-N-[1-(1-methylpiperidin-4-yl)azetidin-3-yl]benzamide |
| SMILES | CN1CCC(N2CC(N(C)C(=O)c3ccccc3C=O)C2)CC1 |
| InChI | InChI=1S/C18H25N3O2/c1-19-9-7-15(8-10-19)21-11-16(12-21)20(2)18(23)17-6-4-3-5-14(17)13-22/h3-6,13,15-16H,7-12H2,1-2H3 |
| InChIKey | DTPRESZPWHMOIT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|