C14H23N3O2 — CID 167913912
3-(4-methoxyoxan-4-yl)-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine (PubChem CID 167913912) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 3-(4-methoxyoxan-4-yl)-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine.
| Compound Name | 3-(4-methoxyoxan-4-yl)-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine |
|---|---|
| PubChem CID | 167913912 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 3-(4-methoxyoxan-4-yl)-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine |
| SMILES | COC1(c2nnc3n2CCCCCC3)CCOCC1 |
| InChI | InChI=1S/C14H23N3O2/c1-18-14(7-10-19-11-8-14)13-16-15-12-6-4-2-3-5-9-17(12)13/h2-11H2,1H3 |
| InChIKey | LYTCXABRPKFVJP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |