C18H18N6O — CID 167915157
1-(1H-benzimidazol-2-ylmethyl)-3-[(1-methylindazol-4-yl)methyl]urea (PubChem CID 167915157) has the molecular formula C18H18N6O and a molecular weight of 334.38 g/mol. Its IUPAC name is 1-(1H-benzimidazol-2-ylmethyl)-3-[(1-methylindazol-4-yl)methyl]urea.
| Compound Name | 1-(1H-benzimidazol-2-ylmethyl)-3-[(1-methylindazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 167915157 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-(1H-benzimidazol-2-ylmethyl)-3-[(1-methylindazol-4-yl)methyl]urea |
| SMILES | Cn1ncc2c(CNC(=O)NCc3nc4ccccc4[nH]3)cccc21 |
| InChI | InChI=1S/C18H18N6O/c1-24-16-8-4-5-12(13(16)10-21-24)9-19-18(25)20-11-17-22-14-6-2-3-7-15(14)23-17/h2-8,10H,9,11H2,1H3,(H,22,23)(H2,19,20,25) |
| InChIKey | ZGCZFRGCXYGPGY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |