C22H20N4O3 — CID 167919345
4-[[(1-benzylindole-2-carbonyl)amino]methyl]-1-methylpyrazole-5-carboxylic acid (PubChem CID 167919345) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 4-[[(1-benzylindole-2-carbonyl)amino]methyl]-1-methylpyrazole-5-carboxylic acid.
| Compound Name | 4-[[(1-benzylindole-2-carbonyl)amino]methyl]-1-methylpyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 167919345 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 4-[[(1-benzylindole-2-carbonyl)amino]methyl]-1-methylpyrazole-5-carboxylic acid |
| SMILES | Cn1ncc(CNC(=O)c2cc3ccccc3n2Cc2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C22H20N4O3/c1-25-20(22(28)29)17(13-24-25)12-23-21(27)19-11-16-9-5-6-10-18(16)26(19)14-15-7-3-2-4-8-15/h2-11,13H,12,14H2,1H3,(H,23,27)(H,28,29) |
| InChIKey | VMSBKFNXQUQZLA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |