C17H25N3O2 — CID 167919475
1-[(1-cyclobutylpyrazol-4-yl)methyl]-4-prop-2-enylpiperidine-4-carboxylic acid (PubChem CID 167919475) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-[(1-cyclobutylpyrazol-4-yl)methyl]-4-prop-2-enylpiperidine-4-carboxylic acid.
| Compound Name | 1-[(1-cyclobutylpyrazol-4-yl)methyl]-4-prop-2-enylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 167919475 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 1-[(1-cyclobutylpyrazol-4-yl)methyl]-4-prop-2-enylpiperidine-4-carboxylic acid |
| SMILES | C=CCC1(C(=O)O)CCN(Cc2cnn(C3CCC3)c2)CC1 |
| InChI | InChI=1S/C17H25N3O2/c1-2-6-17(16(21)22)7-9-19(10-8-17)12-14-11-18-20(13-14)15-4-3-5-15/h2,11,13,15H,1,3-10,12H2,(H,21,22) |
| InChIKey | NDUYMOHXKOQQFA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|