C22H21N3O2 — CID 167921002
N-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-1,3-diphenylpyrazole-5-carboxamide (PubChem CID 167921002) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is N-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-1,3-diphenylpyrazole-5-carboxamide.
| Compound Name | N-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-1,3-diphenylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 167921002 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-1,3-diphenylpyrazole-5-carboxamide |
| SMILES | O=C(N[C@@H]1C[C@H]2CC[C@@H]1O2)c1cc(-c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C22H21N3O2/c26-22(23-19-13-17-11-12-21(19)27-17)20-14-18(15-7-3-1-4-8-15)24-25(20)16-9-5-2-6-10-16/h1-10,14,17,19,21H,11-13H2,(H,23,26)/t17-,19-,21+/m1/s1 |
| InChIKey | MHEHJXHUBHDSBV-QFUCXCTJSA-N |
| XLogP | 3.59 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |