C17H21N5O — CID 167921131
N-(3-pyrrolidin-1-ylcyclobutyl)-2-(1,2,4-triazol-1-yl)benzamide (PubChem CID 167921131) has the molecular formula C17H21N5O and a molecular weight of 311.39 g/mol. Its IUPAC name is N-(3-pyrrolidin-1-ylcyclobutyl)-2-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-(3-pyrrolidin-1-ylcyclobutyl)-2-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 167921131 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | N-(3-pyrrolidin-1-ylcyclobutyl)-2-(1,2,4-triazol-1-yl)benzamide |
| SMILES | O=C(NC1CC(N2CCCC2)C1)c1ccccc1-n1cncn1 |
| InChI | InChI=1S/C17H21N5O/c23-17(20-13-9-14(10-13)21-7-3-4-8-21)15-5-1-2-6-16(15)22-12-18-11-19-22/h1-2,5-6,11-14H,3-4,7-10H2,(H,20,23) |
| InChIKey | VZOIOEDFJFXRDU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |