C22H23N5O2 — CID 155503009
N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-(1,2,4-triazol-1-yl)benzamide (PubChem CID 155503009) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 155503009 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-(1,2,4-triazol-1-yl)benzamide |
| SMILES | O=C(N[C@H]1C[C@H]2CO[C@@H](c3ccccc3)CN2C1)c1ccccc1-n1cncn1 |
| InChI | InChI=1S/C22H23N5O2/c28-22(19-8-4-5-9-20(19)27-15-23-14-24-27)25-17-10-18-13-29-21(12-26(18)11-17)16-6-2-1-3-7-16/h1-9,14-15,17-18,21H,10-13H2,(H,25,28)/t17-,18-,21+/m0/s1 |
| InChIKey | GLFDQFFFWFXHTJ-BBTUJRGHSA-N |
| XLogP | 2.21 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |