C21H26N4O2 — CID 154819814
N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5-cyclopropyl-1-methylpyrazole-3-carboxamide (PubChem CID 154819814) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5-cyclopropyl-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5-cyclopropyl-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 154819814 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5-cyclopropyl-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)N[C@H]2C[C@H]3CO[C@@H](c4ccccc4)CN3C2)cc1C1CC1 |
| InChI | InChI=1S/C21H26N4O2/c1-24-19(14-7-8-14)10-18(23-24)21(26)22-16-9-17-13-27-20(12-25(17)11-16)15-5-3-2-4-6-15/h2-6,10,14,16-17,20H,7-9,11-13H2,1H3,(H,22,26)/t16-,17-,20+/m0/s1 |
| InChIKey | HLCAMRFUZKURRT-ABSDTBQOSA-N |
| XLogP | 2.24 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |