C22H24N4O2 — CID 155505652
N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5-methylimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 155505652) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5-methylimidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5-methylimidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155505652 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5-methylimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | Cc1cccc2nc(C(=O)N[C@H]3C[C@H]4CO[C@@H](c5ccccc5)CN4C3)cn12 |
| InChI | InChI=1S/C22H24N4O2/c1-15-6-5-9-21-24-19(12-26(15)21)22(27)23-17-10-18-14-28-20(13-25(18)11-17)16-7-3-2-4-8-16/h2-9,12,17-18,20H,10-11,13-14H2,1H3,(H,23,27)/t17-,18-,20+/m0/s1 |
| InChIKey | RRAFOPZJUTUDID-CMKODMSKSA-N |
| XLogP | 2.59 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |