C20H22N6O2 — CID 155494001
N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-7-methyl-[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxamide (PubChem CID 155494001) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-7-methyl-[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxamide.
| Compound Name | N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-7-methyl-[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 155494001 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-7-methyl-[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxamide |
| SMILES | Cc1ccn2c(C(=O)N[C@H]3C[C@H]4CO[C@@H](c5ccccc5)CN4C3)nnc2n1 |
| InChI | InChI=1S/C20H22N6O2/c1-13-7-8-26-18(23-24-20(26)21-13)19(27)22-15-9-16-12-28-17(11-25(16)10-15)14-5-3-2-4-6-14/h2-8,15-17H,9-12H2,1H3,(H,22,27)/t15-,16-,17+/m0/s1 |
| InChIKey | HDFVDGQVYGLHOX-YESZJQIVSA-N |
| XLogP | 1.38 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |