C22H32Cl2N4O2S — CID 163334280
2-[(1S)-1-amino-3-methylbutyl]-N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1,3-thiazole-4-carboxamide;dihydrochloride (PubChem CID 163334280) has the molecular formula C22H32Cl2N4O2S and a molecular weight of 487.50 g/mol. Its IUPAC name is 2-[(1S)-1-amino-3-methylbutyl]-N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1,3-thiazole-4-carboxamide;dihydrochloride.
| Compound Name | 2-[(1S)-1-amino-3-methylbutyl]-N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1,3-thiazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 163334280 |
| Molecular Formula | C22H32Cl2N4O2S |
| Molecular Weight | 487.50 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 2-[(1S)-1-amino-3-methylbutyl]-N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1,3-thiazole-4-carboxamide;dihydrochloride |
| SMILES | CC(C)C[C@H](N)c1nc(C(=O)N[C@H]2C[C@H]3CO[C@@H](c4ccccc4)CN3C2)cs1.Cl.Cl |
| InChI | InChI=1S/C22H30N4O2S.2ClH/c1-14(2)8-18(23)22-25-19(13-29-22)21(27)24-16-9-17-12-28-20(11-26(17)10-16)15-6-4-3-5-7-15;;/h3-7,13-14,16-18,20H,8-12,23H2,1-2H3,(H,24,27);2*1H/t16-,17-,18-,20+;;/m0../s1 |
| InChIKey | HDEQAALNIWELEK-LPFAGCCFSA-N |
| XLogP | 3.98 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |