C11H8BrNO4S — CID 16792115
5-[(5-bromofuran-2-carbonyl)amino]-3-methylthiophene-2-carboxylic acid (PubChem CID 16792115) has the molecular formula C11H8BrNO4S and a molecular weight of 330.16 g/mol. Its IUPAC name is 5-[(5-bromofuran-2-carbonyl)amino]-3-methylthiophene-2-carboxylic acid.
| Compound Name | 5-[(5-bromofuran-2-carbonyl)amino]-3-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 16792115 |
| Molecular Formula | C11H8BrNO4S |
| Molecular Weight | 330.16 g/mol |
| Exact Mass | 328.94 |
| IUPAC Name | 5-[(5-bromofuran-2-carbonyl)amino]-3-methylthiophene-2-carboxylic acid |
| SMILES | Cc1cc(NC(=O)c2ccc(Br)o2)sc1C(=O)O |
| InChI | InChI=1S/C11H8BrNO4S/c1-5-4-8(18-9(5)11(15)16)13-10(14)6-2-3-7(12)17-6/h2-4H,1H3,(H,13,14)(H,15,16) |
| InChIKey | SDIROUOGSABNOH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.16 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |