C21H29N3O3 — CID 167922647
1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-4-(3,3,5,5-tetramethylpiperazin-1-yl)butane-1,4-dione (PubChem CID 167922647) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-4-(3,3,5,5-tetramethylpiperazin-1-yl)butane-1,4-dione.
| Compound Name | 1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-4-(3,3,5,5-tetramethylpiperazin-1-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 167922647 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-4-(3,3,5,5-tetramethylpiperazin-1-yl)butane-1,4-dione |
| SMILES | CC1(C)CN(C(=O)CCC(=O)c2ccc3c(c2)CCC(=O)N3)CC(C)(C)N1 |
| InChI | InChI=1S/C21H29N3O3/c1-20(2)12-24(13-21(3,4)23-20)19(27)10-8-17(25)15-5-7-16-14(11-15)6-9-18(26)22-16/h5,7,11,23H,6,8-10,12-13H2,1-4H3,(H,22,26) |
| InChIKey | LBAIEVARRMNPBF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |