C17H15NO2S — CID 2801269
6-(2-phenylsulfanylacetyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 2801269) has the molecular formula C17H15NO2S and a molecular weight of 297.38 g/mol. Its IUPAC name is 6-(2-phenylsulfanylacetyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(2-phenylsulfanylacetyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 2801269 |
| Molecular Formula | C17H15NO2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 6-(2-phenylsulfanylacetyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(C(=O)CSc3ccccc3)ccc2N1 |
| InChI | InChI=1S/C17H15NO2S/c19-16(11-21-14-4-2-1-3-5-14)13-6-8-15-12(10-13)7-9-17(20)18-15/h1-6,8,10H,7,9,11H2,(H,18,20) |
| InChIKey | RWBITCHZPCMXCB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |