C18H21BN4O5 — CID 167923281
[2-formyl-4-[2-[[methyl(pyridazin-3-yl)amino]methyl]morpholine-4-carbonyl]phenyl]boronic acid (PubChem CID 167923281) has the molecular formula C18H21BN4O5 and a molecular weight of 384.20 g/mol. Its IUPAC name is [2-formyl-4-[2-[[methyl(pyridazin-3-yl)amino]methyl]morpholine-4-carbonyl]phenyl]boronic acid.
| Compound Name | [2-formyl-4-[2-[[methyl(pyridazin-3-yl)amino]methyl]morpholine-4-carbonyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 167923281 |
| Molecular Formula | C18H21BN4O5 |
| Molecular Weight | 384.20 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | [2-formyl-4-[2-[[methyl(pyridazin-3-yl)amino]methyl]morpholine-4-carbonyl]phenyl]boronic acid |
| SMILES | CN(CC1CN(C(=O)c2ccc(B(O)O)c(C=O)c2)CCO1)c1cccnn1 |
| InChI | InChI=1S/C18H21BN4O5/c1-22(17-3-2-6-20-21-17)10-15-11-23(7-8-28-15)18(25)13-4-5-16(19(26)27)14(9-13)12-24/h2-6,9,12,15,26-27H,7-8,10-11H2,1H3 |
| InChIKey | ZFERNGNOPLLGGY-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.20 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|