C20H24N4O4 — CID 167923890
2-oxo-2-(10-oxo-3,9-diazabicyclo[3.3.2]decan-3-yl)-N-(1-oxo-2,3,4,5-tetrahydro-2-benzazepin-8-yl)acetamide (PubChem CID 167923890) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 2-oxo-2-(10-oxo-3,9-diazabicyclo[3.3.2]decan-3-yl)-N-(1-oxo-2,3,4,5-tetrahydro-2-benzazepin-8-yl)acetamide.
| Compound Name | 2-oxo-2-(10-oxo-3,9-diazabicyclo[3.3.2]decan-3-yl)-N-(1-oxo-2,3,4,5-tetrahydro-2-benzazepin-8-yl)acetamide |
|---|---|
| PubChem CID | 167923890 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-oxo-2-(10-oxo-3,9-diazabicyclo[3.3.2]decan-3-yl)-N-(1-oxo-2,3,4,5-tetrahydro-2-benzazepin-8-yl)acetamide |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)NCCC2)C(=O)N1CC2CCCC(C1)C(=O)N2 |
| InChI | InChI=1S/C20H24N4O4/c25-17-13-3-1-5-15(23-17)11-24(10-13)20(28)19(27)22-14-7-6-12-4-2-8-21-18(26)16(12)9-14/h6-7,9,13,15H,1-5,8,10-11H2,(H,21,26)(H,22,27)(H,23,25) |
| InChIKey | YGZABSJNBRNBKP-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|