C12H7ClFN3O — CID 167924531
N-(3-chloro-4-fluorophenyl)furo[2,3-d]pyridazin-7-amine (PubChem CID 167924531) has the molecular formula C12H7ClFN3O and a molecular weight of 263.66 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)furo[2,3-d]pyridazin-7-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)furo[2,3-d]pyridazin-7-amine |
|---|---|
| PubChem CID | 167924531 |
| Molecular Formula | C12H7ClFN3O |
| Molecular Weight | 263.66 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)furo[2,3-d]pyridazin-7-amine |
| SMILES | Fc1ccc(Nc2nncc3ccoc23)cc1Cl |
| InChI | InChI=1S/C12H7ClFN3O/c13-9-5-8(1-2-10(9)14)16-12-11-7(3-4-18-11)6-15-17-12/h1-6H,(H,16,17) |
| InChIKey | XPJGLLJCZSMIOS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.66 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |