C14H20O4S — CID 167925614
methyl 3-[(4-hydroxycyclohexyl)methoxy]-4-methylthiophene-2-carboxylate (PubChem CID 167925614) has the molecular formula C14H20O4S and a molecular weight of 284.38 g/mol. Its IUPAC name is methyl 3-[(4-hydroxycyclohexyl)methoxy]-4-methylthiophene-2-carboxylate.
| Compound Name | methyl 3-[(4-hydroxycyclohexyl)methoxy]-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 167925614 |
| Molecular Formula | C14H20O4S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | methyl 3-[(4-hydroxycyclohexyl)methoxy]-4-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1OCC1CCC(O)CC1 |
| InChI | InChI=1S/C14H20O4S/c1-9-8-19-13(14(16)17-2)12(9)18-7-10-3-5-11(15)6-4-10/h8,10-11,15H,3-7H2,1-2H3 |
| InChIKey | MPRVBKBKXJRIMR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |