C8H11ClN2O2 — CID 167926313
2-chloro-N-[(4-ethyl-1,3-oxazol-5-yl)methyl]acetamide (PubChem CID 167926313) has the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. Its IUPAC name is 2-chloro-N-[(4-ethyl-1,3-oxazol-5-yl)methyl]acetamide.
| Compound Name | 2-chloro-N-[(4-ethyl-1,3-oxazol-5-yl)methyl]acetamide |
|---|---|
| PubChem CID | 167926313 |
| Molecular Formula | C8H11ClN2O2 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 2-chloro-N-[(4-ethyl-1,3-oxazol-5-yl)methyl]acetamide |
| SMILES | CCc1ncoc1CNC(=O)CCl |
| InChI | InChI=1S/C8H11ClN2O2/c1-2-6-7(13-5-11-6)4-10-8(12)3-9/h5H,2-4H2,1H3,(H,10,12) |
| InChIKey | FQBAJNDFUWMVGL-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|