C19H24N2O2 — CID 167926329
2-(2-phenyl-1,3-oxazol-4-yl)-N-(2-propan-2-ylcyclopentyl)acetamide (PubChem CID 167926329) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-(2-phenyl-1,3-oxazol-4-yl)-N-(2-propan-2-ylcyclopentyl)acetamide.
| Compound Name | 2-(2-phenyl-1,3-oxazol-4-yl)-N-(2-propan-2-ylcyclopentyl)acetamide |
|---|---|
| PubChem CID | 167926329 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 2-(2-phenyl-1,3-oxazol-4-yl)-N-(2-propan-2-ylcyclopentyl)acetamide |
| SMILES | CC(C)C1CCCC1NC(=O)Cc1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H24N2O2/c1-13(2)16-9-6-10-17(16)21-18(22)11-15-12-23-19(20-15)14-7-4-3-5-8-14/h3-5,7-8,12-13,16-17H,6,9-11H2,1-2H3,(H,21,22) |
| InChIKey | BYASMZPNDCKMER-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |