C20H17F3O5 — CID 167927166
6-(2,5-dimethoxyphenyl)naphthalen-2-ol;2,2,2-trifluoroacetic acid (PubChem CID 167927166) has the molecular formula C20H17F3O5 and a molecular weight of 394.35 g/mol. Its IUPAC name is 6-(2,5-dimethoxyphenyl)naphthalen-2-ol;2,2,2-trifluoroacetic acid.
| Compound Name | 6-(2,5-dimethoxyphenyl)naphthalen-2-ol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167927166 |
| Molecular Formula | C20H17F3O5 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 6-(2,5-dimethoxyphenyl)naphthalen-2-ol;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(OC)c(-c2ccc3cc(O)ccc3c2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H16O3.C2HF3O2/c1-20-16-7-8-18(21-2)17(11-16)14-4-3-13-10-15(19)6-5-12(13)9-14;3-2(4,5)1(6)7/h3-11,19H,1-2H3;(H,6,7) |
| InChIKey | UNXCZKDHRZTWEU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |