C13H23NO — CID 167927925
cyclobutyl-(2,2-diethylpyrrolidin-1-yl)methanone (PubChem CID 167927925) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is cyclobutyl-(2,2-diethylpyrrolidin-1-yl)methanone.
| Compound Name | cyclobutyl-(2,2-diethylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 167927925 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | cyclobutyl-(2,2-diethylpyrrolidin-1-yl)methanone |
| SMILES | CCC1(CC)CCCN1C(=O)C1CCC1 |
| InChI | InChI=1S/C13H23NO/c1-3-13(4-2)9-6-10-14(13)12(15)11-7-5-8-11/h11H,3-10H2,1-2H3 |
| InChIKey | VDKWQBJDWWIFEG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |