C12H20N2O3 — CID 167930532
tert-butyl N-[(2-oxo-1-azaspiro[3.3]heptan-6-yl)methyl]carbamate (PubChem CID 167930532) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is tert-butyl N-[(2-oxo-1-azaspiro[3.3]heptan-6-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(2-oxo-1-azaspiro[3.3]heptan-6-yl)methyl]carbamate |
|---|---|
| PubChem CID | 167930532 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | tert-butyl N-[(2-oxo-1-azaspiro[3.3]heptan-6-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CC2(CC(=O)N2)C1 |
| InChI | InChI=1S/C12H20N2O3/c1-11(2,3)17-10(16)13-7-8-4-12(5-8)6-9(15)14-12/h8H,4-7H2,1-3H3,(H,13,16)(H,14,15) |
| InChIKey | IRVLLUMDXNFJAD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |