C9H16N2O3 — CID 125489322
tert-butyl N-[[(3S)-2-oxoazetidin-3-yl]methyl]carbamate (PubChem CID 125489322) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is tert-butyl N-[[(3S)-2-oxoazetidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(3S)-2-oxoazetidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 125489322 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | tert-butyl N-[[(3S)-2-oxoazetidin-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@@H]1CNC1=O |
| InChI | InChI=1S/C9H16N2O3/c1-9(2,3)14-8(13)11-5-6-4-10-7(6)12/h6H,4-5H2,1-3H3,(H,10,12)(H,11,13)/t6-/m0/s1 |
| InChIKey | IKBXVBJVHAFIIW-LURJTMIESA-N |
| XLogP | 0.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |