C16H13FN6O2 — CID 167931784
6-[(2E)-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methylidene]hydrazinyl]-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 167931784) has the molecular formula C16H13FN6O2 and a molecular weight of 340.32 g/mol. Its IUPAC name is 6-[(2E)-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methylidene]hydrazinyl]-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-[(2E)-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methylidene]hydrazinyl]-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 167931784 |
| Molecular Formula | C16H13FN6O2 |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 6-[(2E)-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methylidene]hydrazinyl]-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | Cc1c(/C=N/Nc2nc3c(cnn3C)c(=O)[nH]2)oc2ccc(F)cc12 |
| InChI | InChI=1S/C16H13FN6O2/c1-8-10-5-9(17)3-4-12(10)25-13(8)7-18-22-16-20-14-11(15(24)21-16)6-19-23(14)2/h3-7H,1-2H3,(H2,20,21,22,24)/b18-7+ |
| InChIKey | FCWSPDCSZMBDJD-CNHKJKLMSA-N |
| XLogP | 2.30 |
| TPSA | 101.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|