C16H26N4O6 — CID 167931999
tert-butyl 7-[2-hydroxy-2-(3-hydroxyoxolan-3-yl)ethyl]-3-oxo-2,5,6,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxylate (PubChem CID 167931999) has the molecular formula C16H26N4O6 and a molecular weight of 370.41 g/mol. Its IUPAC name is tert-butyl 7-[2-hydroxy-2-(3-hydroxyoxolan-3-yl)ethyl]-3-oxo-2,5,6,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxylate.
| Compound Name | tert-butyl 7-[2-hydroxy-2-(3-hydroxyoxolan-3-yl)ethyl]-3-oxo-2,5,6,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxylate |
|---|---|
| PubChem CID | 167931999 |
| Molecular Formula | C16H26N4O6 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | tert-butyl 7-[2-hydroxy-2-(3-hydroxyoxolan-3-yl)ethyl]-3-oxo-2,5,6,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1Cn2c(n[nH]c2=O)CN1CC(O)C1(O)CCOC1 |
| InChI | InChI=1S/C16H26N4O6/c1-15(2,3)26-13(22)10-6-20-12(17-18-14(20)23)8-19(10)7-11(21)16(24)4-5-25-9-16/h10-11,21,24H,4-9H2,1-3H3,(H,18,23) |
| InChIKey | JDMYSLIHNKLYSV-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 129.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |