C16H18N2O3S — CID 167932235
2-methoxy-N-[5-(oxan-4-yl)-1,3-thiazol-2-yl]benzamide (PubChem CID 167932235) has the molecular formula C16H18N2O3S and a molecular weight of 318.40 g/mol. Its IUPAC name is 2-methoxy-N-[5-(oxan-4-yl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2-methoxy-N-[5-(oxan-4-yl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 167932235 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 2-methoxy-N-[5-(oxan-4-yl)-1,3-thiazol-2-yl]benzamide |
| SMILES | COc1ccccc1C(=O)Nc1ncc(C2CCOCC2)s1 |
| InChI | InChI=1S/C16H18N2O3S/c1-20-13-5-3-2-4-12(13)15(19)18-16-17-10-14(22-16)11-6-8-21-9-7-11/h2-5,10-11H,6-9H2,1H3,(H,17,18,19) |
| InChIKey | VWZJVOBIILGABN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |