C16H19FN4O3 — CID 167933715
N-(2-fluoro-3-methoxy-4-pyridinyl)-5-methyl-2-(oxan-4-yl)pyrazole-3-carboxamide (PubChem CID 167933715) has the molecular formula C16H19FN4O3 and a molecular weight of 334.35 g/mol. Its IUPAC name is N-(2-fluoro-3-methoxy-4-pyridinyl)-5-methyl-2-(oxan-4-yl)pyrazole-3-carboxamide.
| Compound Name | N-(2-fluoro-3-methoxy-4-pyridinyl)-5-methyl-2-(oxan-4-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 167933715 |
| Molecular Formula | C16H19FN4O3 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | N-(2-fluoro-3-methoxy-4-pyridinyl)-5-methyl-2-(oxan-4-yl)pyrazole-3-carboxamide |
| SMILES | COc1c(NC(=O)c2cc(C)nn2C2CCOCC2)ccnc1F |
| InChI | InChI=1S/C16H19FN4O3/c1-10-9-13(21(20-10)11-4-7-24-8-5-11)16(22)19-12-3-6-18-15(17)14(12)23-2/h3,6,9,11H,4-5,7-8H2,1-2H3,(H,18,19,22) |
| InChIKey | PIBUPZPOZHEVEZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|