C16H20N6O3 — CID 167935467
methyl 6-[4-(4-methoxy-6-methylpyrimidin-2-yl)piperazin-1-yl]pyridazine-3-carboxylate (PubChem CID 167935467) has the molecular formula C16H20N6O3 and a molecular weight of 344.38 g/mol. Its IUPAC name is methyl 6-[4-(4-methoxy-6-methylpyrimidin-2-yl)piperazin-1-yl]pyridazine-3-carboxylate.
| Compound Name | methyl 6-[4-(4-methoxy-6-methylpyrimidin-2-yl)piperazin-1-yl]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 167935467 |
| Molecular Formula | C16H20N6O3 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | methyl 6-[4-(4-methoxy-6-methylpyrimidin-2-yl)piperazin-1-yl]pyridazine-3-carboxylate |
| SMILES | COC(=O)c1ccc(N2CCN(c3nc(C)cc(OC)n3)CC2)nn1 |
| InChI | InChI=1S/C16H20N6O3/c1-11-10-14(24-2)18-16(17-11)22-8-6-21(7-9-22)13-5-4-12(19-20-13)15(23)25-3/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | FIPKUXMQRSNMDQ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 93.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |