C16H17N5O4S — CID 167937136
1-methyl-4-[[2-(2-phenylethyl)pyrazol-3-yl]sulfonylamino]pyrazole-3-carboxylic acid (PubChem CID 167937136) has the molecular formula C16H17N5O4S and a molecular weight of 375.41 g/mol. Its IUPAC name is 1-methyl-4-[[2-(2-phenylethyl)pyrazol-3-yl]sulfonylamino]pyrazole-3-carboxylic acid.
| Compound Name | 1-methyl-4-[[2-(2-phenylethyl)pyrazol-3-yl]sulfonylamino]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 167937136 |
| Molecular Formula | C16H17N5O4S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 1-methyl-4-[[2-(2-phenylethyl)pyrazol-3-yl]sulfonylamino]pyrazole-3-carboxylic acid |
| SMILES | Cn1cc(NS(=O)(=O)c2ccnn2CCc2ccccc2)c(C(=O)O)n1 |
| InChI | InChI=1S/C16H17N5O4S/c1-20-11-13(15(18-20)16(22)23)19-26(24,25)14-7-9-17-21(14)10-8-12-5-3-2-4-6-12/h2-7,9,11,19H,8,10H2,1H3,(H,22,23) |
| InChIKey | FJZCNDFWTQTHIS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |