C18H22F3N5O2 — CID 167937559
1-(5-ethyl-4-methyl-1H-pyrazol-3-yl)-3-[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]urea (PubChem CID 167937559) has the molecular formula C18H22F3N5O2 and a molecular weight of 397.40 g/mol. Its IUPAC name is 1-(5-ethyl-4-methyl-1H-pyrazol-3-yl)-3-[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(5-ethyl-4-methyl-1H-pyrazol-3-yl)-3-[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 167937559 |
| Molecular Formula | C18H22F3N5O2 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 1-(5-ethyl-4-methyl-1H-pyrazol-3-yl)-3-[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]urea |
| SMILES | CCc1[nH]nc(NC(=O)Nc2ccc(N3CCOCC3)cc2C(F)(F)F)c1C |
| InChI | InChI=1S/C18H22F3N5O2/c1-3-14-11(2)16(25-24-14)23-17(27)22-15-5-4-12(10-13(15)18(19,20)21)26-6-8-28-9-7-26/h4-5,10H,3,6-9H2,1-2H3,(H3,22,23,24,25,27) |
| InChIKey | NONZBGZVFNXPBR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |