C21H24FN4O2+ — CID 22479698
N-[3-(4-fluorophenyl)-1H-indazol-5-yl]-4-propylmorpholin-4-ium-4-carboxamide (PubChem CID 22479698) has the molecular formula C21H24FN4O2+ and a molecular weight of 383.45 g/mol. Its IUPAC name is N-[3-(4-fluorophenyl)-1H-indazol-5-yl]-4-propylmorpholin-4-ium-4-carboxamide.
| Compound Name | N-[3-(4-fluorophenyl)-1H-indazol-5-yl]-4-propylmorpholin-4-ium-4-carboxamide |
|---|---|
| PubChem CID | 22479698 |
| Molecular Formula | C21H24FN4O2+ |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | N-[3-(4-fluorophenyl)-1H-indazol-5-yl]-4-propylmorpholin-4-ium-4-carboxamide |
| SMILES | CCC[N+]1(C(=O)Nc2ccc3[nH]nc(-c4ccc(F)cc4)c3c2)CCOCC1 |
| InChI | InChI=1S/C21H23FN4O2/c1-2-9-26(10-12-28-13-11-26)21(27)23-17-7-8-19-18(14-17)20(25-24-19)15-3-5-16(22)6-4-15/h3-8,14H,2,9-13H2,1H3,(H-,23,24,25,27)/p+1 |
| InChIKey | KKOZJVGNBQPHIQ-UHFFFAOYSA-O |
| XLogP | 4.16 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|