C21H23N5O2 — CID 24777773
1-(1H-indazol-4-yl)-3-(4-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl)urea (PubChem CID 24777773) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 1-(1H-indazol-4-yl)-3-(4-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl)urea.
| Compound Name | 1-(1H-indazol-4-yl)-3-(4-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl)urea |
|---|---|
| PubChem CID | 24777773 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 1-(1H-indazol-4-yl)-3-(4-morpholin-4-yl-2,3-dihydro-1H-inden-1-yl)urea |
| SMILES | O=C(Nc1cccc2[nH]ncc12)NC1CCc2c1cccc2N1CCOCC1 |
| InChI | InChI=1S/C21H23N5O2/c27-21(23-17-4-2-5-19-16(17)13-22-25-19)24-18-8-7-15-14(18)3-1-6-20(15)26-9-11-28-12-10-26/h1-6,13,18H,7-12H2,(H,22,25)(H2,23,24,27) |
| InChIKey | ASHXOMOCDINDTE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |