C15H12ClN3O3S — CID 167937890
N-(5-chloroquinoxalin-2-yl)-3-methoxybenzenesulfonamide (PubChem CID 167937890) has the molecular formula C15H12ClN3O3S and a molecular weight of 349.80 g/mol. Its IUPAC name is N-(5-chloroquinoxalin-2-yl)-3-methoxybenzenesulfonamide.
| Compound Name | N-(5-chloroquinoxalin-2-yl)-3-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 167937890 |
| Molecular Formula | C15H12ClN3O3S |
| Molecular Weight | 349.80 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | N-(5-chloroquinoxalin-2-yl)-3-methoxybenzenesulfonamide |
| SMILES | COc1cccc(S(=O)(=O)Nc2cnc3c(Cl)cccc3n2)c1 |
| InChI | InChI=1S/C15H12ClN3O3S/c1-22-10-4-2-5-11(8-10)23(20,21)19-14-9-17-15-12(16)6-3-7-13(15)18-14/h2-9H,1H3,(H,18,19) |
| InChIKey | NNTWTFKAGAUWNO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.80 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |