C17H24NO4P — CID 167937896
methyl (2S,5R)-5-[[3-(1-oxo-1λ5-phospholan-1-yl)anilino]methyl]oxolane-2-carboxylate (PubChem CID 167937896) has the molecular formula C17H24NO4P and a molecular weight of 337.36 g/mol. Its IUPAC name is methyl (2S,5R)-5-[[3-(1-oxo-1λ5-phospholan-1-yl)anilino]methyl]oxolane-2-carboxylate.
| Compound Name | methyl (2S,5R)-5-[[3-(1-oxo-1λ5-phospholan-1-yl)anilino]methyl]oxolane-2-carboxylate |
|---|---|
| PubChem CID | 167937896 |
| Molecular Formula | C17H24NO4P |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | methyl (2S,5R)-5-[[3-(1-oxo-1λ5-phospholan-1-yl)anilino]methyl]oxolane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@H](CNc2cccc(P3(=O)CCCC3)c2)O1 |
| InChI | InChI=1S/C17H24NO4P/c1-21-17(19)16-8-7-14(22-16)12-18-13-5-4-6-15(11-13)23(20)9-2-3-10-23/h4-6,11,14,16,18H,2-3,7-10,12H2,1H3/t14-,16+/m1/s1 |
| InChIKey | LOWAWAHLSITSEY-ZBFHGGJFSA-N |
| XLogP | 2.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|