C23H22N8O3 — CID 167939301
N-[1-[[1-(cyanomethyl)cyclopropyl]methyl]-2-oxo-3,4-dihydroquinolin-6-yl]-2-oxo-2-[2-([1,2,4]triazolo[1,5-a]pyridin-2-yl)hydrazinyl]acetamide (PubChem CID 167939301) has the molecular formula C23H22N8O3 and a molecular weight of 458.48 g/mol. Its IUPAC name is N-[1-[[1-(cyanomethyl)cyclopropyl]methyl]-2-oxo-3,4-dihydroquinolin-6-yl]-2-oxo-2-[2-([1,2,4]triazolo[1,5-a]pyridin-2-yl)hydrazinyl]acetamide.
| Compound Name | N-[1-[[1-(cyanomethyl)cyclopropyl]methyl]-2-oxo-3,4-dihydroquinolin-6-yl]-2-oxo-2-[2-([1,2,4]triazolo[1,5-a]pyridin-2-yl)hydrazinyl]acetamide |
|---|---|
| PubChem CID | 167939301 |
| Molecular Formula | C23H22N8O3 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | N-[1-[[1-(cyanomethyl)cyclopropyl]methyl]-2-oxo-3,4-dihydroquinolin-6-yl]-2-oxo-2-[2-([1,2,4]triazolo[1,5-a]pyridin-2-yl)hydrazinyl]acetamide |
| SMILES | N#CCC1(CN2C(=O)CCc3cc(NC(=O)C(=O)NNc4nc5ccccn5n4)ccc32)CC1 |
| InChI | InChI=1S/C23H22N8O3/c24-11-10-23(8-9-23)14-30-17-6-5-16(13-15(17)4-7-19(30)32)25-20(33)21(34)27-28-22-26-18-3-1-2-12-31(18)29-22/h1-3,5-6,12-13H,4,7-10,14H2,(H,25,33)(H,27,34)(H,28,29) |
| InChIKey | HGDNWFSVLBDDNQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|