C18H14F2N2O2 — CID 167943855
3-[(2S)-2-(2,4-difluorophenyl)-2-hydroxyethyl]-6-phenylpyrimidin-4-one (PubChem CID 167943855) has the molecular formula C18H14F2N2O2 and a molecular weight of 328.32 g/mol. Its IUPAC name is 3-[(2S)-2-(2,4-difluorophenyl)-2-hydroxyethyl]-6-phenylpyrimidin-4-one.
| Compound Name | 3-[(2S)-2-(2,4-difluorophenyl)-2-hydroxyethyl]-6-phenylpyrimidin-4-one |
|---|---|
| PubChem CID | 167943855 |
| Molecular Formula | C18H14F2N2O2 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 3-[(2S)-2-(2,4-difluorophenyl)-2-hydroxyethyl]-6-phenylpyrimidin-4-one |
| SMILES | O=c1cc(-c2ccccc2)ncn1C[C@@H](O)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H14F2N2O2/c19-13-6-7-14(15(20)8-13)17(23)10-22-11-21-16(9-18(22)24)12-4-2-1-3-5-12/h1-9,11,17,23H,10H2/t17-/m1/s1 |
| InChIKey | MCSKDXGPPHXQTH-QGZVFWFLSA-N |
| XLogP | 2.92 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |