C23H23NO3 — CID 167943972
[4-(pyridin-3-ylmethoxy)phenyl]methyl 2-(3,4-dimethylphenyl)acetate (PubChem CID 167943972) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is [4-(pyridin-3-ylmethoxy)phenyl]methyl 2-(3,4-dimethylphenyl)acetate.
| Compound Name | [4-(pyridin-3-ylmethoxy)phenyl]methyl 2-(3,4-dimethylphenyl)acetate |
|---|---|
| PubChem CID | 167943972 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | [4-(pyridin-3-ylmethoxy)phenyl]methyl 2-(3,4-dimethylphenyl)acetate |
| SMILES | Cc1ccc(CC(=O)OCc2ccc(OCc3cccnc3)cc2)cc1C |
| InChI | InChI=1S/C23H23NO3/c1-17-5-6-20(12-18(17)2)13-23(25)27-15-19-7-9-22(10-8-19)26-16-21-4-3-11-24-14-21/h3-12,14H,13,15-16H2,1-2H3 |
| InChIKey | FAWCGGDPNHDKEE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |